loading...| Preferred Name |
brivaracetam |
| Synonyms |
2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide Briviact brivaracetam UCB 34714 (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide UCB34714 |
| Definitions |
A non-proteinogenic amino acid derivative that is butanamide in which the pro-S hydrogen at position 2 is replaced by a (4R)-2-oxo-4-propylpyrrolidin-1-yl. Used for treatment of partial onset seizures related to epilepsy. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_133013 |
| charge |
0 |
| database_cross_reference |
PMID:26760311 PMID:27192732 PMID:26920914 Wikipedia:Brivaracetam PMID:26891946 PMID:27221208 PMID:27217762 CAS:357336-20-0 PMID:27146213 PMID:27252986 PMID:27236448 PMID:26666500 PMID:27346728 Drug_Central:5068 PMID:27450143 PMID:26719676 Reaxys:9629290 PMID:26664121 PMID:27265725 PMID:27389600 PMID:26515103 PMID:26899665 PMID:26740317 KEGG:D08879 PMID:27335114 PMID:26944275 PMID:27274002 PMID:27503181 PMID:27002062 PMID:27403785 |
| definition |
A non-proteinogenic amino acid derivative that is butanamide in which the pro-S hydrogen at position 2 is replaced by a (4R)-2-oxo-4-propylpyrrolidin-1-yl. Used for treatment of partial onset seizures related to epilepsy. |
| formula |
C11H20N2O2 |
| has functional parent | |
| has role | |
| has_exact_synonym |
(2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide Briviact brivaracetam UCB 34714 UCB34714 |
| id |
CHEBI:133013 |
| in_subset | |
| inchi |
InChI=1S/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9+/m1/s1 |
| inchikey |
MSYKRHVOOPPJKU-BDAKNGLRSA-N |
| label |
brivaracetam |
| mass |
212.289 |
| monoisotopicmass |
212.152 |
| notation |
CHEBI:133013 |
| prefLabel |
brivaracetam |
| smiles |
N1([C@H](C(N)=O)CC)C(C[C@H](C1)CCC)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C482793 | Medical Subject Headings | LOOM | |
| http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C65270 | National Cancer Institute Thesaurus | LOOM |