loading...| Preferred Name |
8-oxoadenine |
| Synonyms |
7,8-Dihydro-8-oxoadenine 6-amino-1,7-dihydro-8H-purin-8-one 8-oxoA 8-oxo-7,8-dihydroadenine Oxyadenine |
| Definitions |
A oxopurine that is adenine bearing a single oxo substituent at position 8. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_134104 |
| charge |
0 |
| database_cross_reference |
PMID:9683192 PMID:1851559 PMID:12644468 HMDB:HMDB0000542 Reaxys:151789 PMID:11747549 PMID:26861551 PMID:10780366 PMID:8461291 PMID:15351402 PMID:24692658 PMID:23209024 PMID:23265901 KNApSAcK:C00043227 PMID:26188111 CAS:21149-26-8 PMID:12688418 PMID:25782998 PMID:21391900 PMID:2798767 PMID:8652548 |
| definition |
A oxopurine that is adenine bearing a single oxo substituent at position 8. |
| formula |
C5H5N5O |
| has functional parent | |
| has role | |
| has_exact_synonym |
6-amino-1,7-dihydro-8H-purin-8-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
7,8-Dihydro-8-oxoadenine 8-oxoA 8-oxo-7,8-dihydroadenine Oxyadenine |
| id |
CHEBI:134104 |
| in_subset | |
| inchi |
InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H4,6,7,8,9,10,11) |
| inchikey |
RGKBRPAAQSHTED-UHFFFAOYSA-N |
| is tautomer of | |
| label |
8-oxoadenine |
| mass |
151.126 |
| monoisotopicmass |
151.049 |
| notation |
CHEBI:134104 |
| prefLabel |
8-oxoadenine |
| smiles |
C=12C(=NC=NC1N)NC(N2)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25810 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25810 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001967 | Sequence Types and Features Ontology | LOOM |