loading...| Preferred Name |
leucomethylene blue |
| Synonyms |
Panatone Reduced methylene blue N(3),N(3),N(7),N(7)-tetramethyl-10H-phenothiazine-3,7-diamine |
| Definitions |
A member of the class of phenothiazines that is 10H-phenothiazine in which the ring hydrogens at positions 3 and 7 have been replaced by dimethylamino groups. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_134180 |
| charge |
0 |
| database_cross_reference |
Chemspider:144378 Reaxys:29531 PMID:22256987 PMID:4098644 PMID:20629071 PMID:52997 PMID:16260876 PMID:4191870 PMID:4117328 PMID:4191509 KEGG:C05721 PMID:21275052 PMID:15808010 PMID:4727172 PMID:6161670 CAS:613-11-6 PMID:28084524 PMID:5896428 PMID:6203133 PMID:5149370 PMID:14226920 |
| definition |
A member of the class of phenothiazines that is 10H-phenothiazine in which the ring hydrogens at positions 3 and 7 have been replaced by dimethylamino groups. |
| formula |
C16H19N3S |
| has role |
http://purl.obolibrary.org/obo/CHEBI_76976 http://purl.obolibrary.org/obo/CHEBI_51217 |
| has_alternative_id |
CHEBI:8796 |
| has_exact_synonym |
N(3),N(3),N(7),N(7)-tetramethyl-10H-phenothiazine-3,7-diamine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Panatone Reduced methylene blue |
| id |
CHEBI:134180 |
| in_subset | |
| inchi |
InChI=1S/C16H19N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10,17H,1-4H3 |
| inchikey |
QTWZICCBKBYHDM-UHFFFAOYSA-N |
| label |
leucomethylene blue |
| mass |
285.409 |
| monoisotopicmass |
285.130 |
| notation |
CHEBI:134180 |
| prefLabel |
leucomethylene blue |
| smiles |
CN(C)C=1C=CC2=C(C1)SC=3C=C(C=CC3N2)N(C)C |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50996 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50996 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C011010 | Medical Subject Headings | LOOM |