loading...| Preferred Name |
uridine |
| Synonyms |
Uridin 1-beta-D-ribofuranosylpyrimidine-2,4(1H,3H)-dione Urd URIDINE 1-beta-D-ribofuranosyluracil uridine beta-Uridine u Uridine |
| Definitions |
A ribonucleoside composed of a molecule of uracil attached to a ribofuranose moiety via a beta-N(1)-glycosidic bond. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16704 |
| charge |
0 |
| database_cross_reference |
Gmelin:397474 PMID:12084455 PMID:22770225 PMID:17190852 PMID:15621516 PMID:22392515 Reaxys:754904 HMDB:HMDB0000296 YMDB:YMDB00127 Beilstein:754904 KEGG:C00299 CAS:58-96-8 MetaCyc:URIDINE PDBeChem:URI DrugBank:DB02745 KNApSAcK:C00019674 ECMDB:ECMDB00296 PMID:16839635 Wikipedia:Uridine |
| definition |
A ribonucleoside composed of a molecule of uracil attached to a ribofuranose moiety via a beta-N(1)-glycosidic bond. |
| formula |
C9H12N2O6 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_49103 |
| has_alternative_id |
CHEBI:15296 CHEBI:46460 CHEBI:27227 CHEBI:9893 CHEBI:46391 CHEBI:46386 |
| has_exact_synonym |
URIDINE uridine Uridine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Uridin 1-beta-D-ribofuranosylpyrimidine-2,4(1H,3H)-dione Urd 1-beta-D-ribofuranosyluracil beta-Uridine u |
| id |
CHEBI:16704 |
| in_subset | |
| inchi |
InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| inchikey |
DRTQHJPVMGBUCF-XVFCMESISA-N |
| label |
uridine |
| mass |
244.20146 |
| monoisotopicmass |
244.070 |
| notation |
CHEBI:16704 |
| prefLabel |
uridine |
| smiles |
OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1ccc(=O)[nH]c1=O |
| treeView | |
| subClassOf |