loading...| Preferred Name |
N(2)-methylguanosine |
| Synonyms |
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2-(methylamino)-1,9-dihydro-6H-purin-6-one 2-(methylamino)-9-(beta-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-one m2g N-methylguanosine 7-Methylguanosine 2-Methylguanosine N(2)-Methylguanosine |
| Definitions |
Guanosine with the hydrogen on the amine at position N-2 substituted with a methyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_19702 |
| charge |
0 |
| database_cross_reference |
PMID:22770225 CAS:2140-77-4 Reaxys:1031383 Reaxys:46491 PMID:21735129 PMID:22337946 HMDB:HMDB0005862 |
| definition |
Guanosine with the hydrogen on the amine at position N-2 substituted with a methyl group. |
| formula |
C11H15N5O5 |
| has role | |
| has_exact_synonym |
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2-(methylamino)-1,9-dihydro-6H-purin-6-one N-methylguanosine N(2)-Methylguanosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(methylamino)-9-(beta-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-one m2g 7-Methylguanosine 2-Methylguanosine |
| id |
CHEBI:19702 |
| in_subset | |
| inchi |
InChI=1S/C11H15N5O5/c1-12-11-14-8-5(9(20)15-11)13-3-16(8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15,20)/t4-,6-,7-,10-/m1/s1 |
| inchikey |
SLEHROROQDYRAW-KQYNXXCUSA-N |
| label |
N(2)-methylguanosine |
| mass |
297.26750 |
| monoisotopicmass |
297.107 |
| notation |
CHEBI:19702 |
| prefLabel |
N(2)-methylguanosine |
| smiles |
CNc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001325 | Sequence Types and Features Ontology | LOOM |