Jump to:
loading...| Preferred Name |
androstane-3,17-dione |
| Synonyms |
androstane-3,17-dione |
| Definitions |
An androstanoid that is androstane substituted by oxo groups at positions 3 and 17. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_22542 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Androstanedione |
| definition |
An androstanoid that is androstane substituted by oxo groups at positions 3 and 17. |
| formula |
C19H28O2 |
| has role | |
| has_exact_synonym |
androstane-3,17-dione |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:22542 |
| in_subset | |
| inchi |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-16H,3-11H2,1-2H3/t12?,14-,15-,16-,18-,19-/m0/s1 |
| inchikey |
RAJWOBJTTGJROA-RNQTWYFASA-N |
| label |
androstane-3,17-dione |
| mass |
288.42440 |
| monoisotopicmass |
288.209 |
| notation |
CHEBI:22542 |
| prefLabel |
androstane-3,17-dione |
| smiles |
C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)CC[C@]34C)[C@@H]1CCC2=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50402 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C006576 | Medical Subject Headings | LOOM |