loading...| Preferred Name |
dihydrouridine |
| Synonyms |
5,6-dihydrouridine 3,4-Dihydrouridine 1-beta-D-ribofuranosylhydrouracil D |
| Definitions |
The uridine derivative obtained by formal hydrogenation of the endocyclic double bond in the uracil ring. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_23774 |
| charge |
0 |
| database_cross_reference |
PMID:5133096 PMID:9417777 PMID:21628433 PMID:5640373 PMID:2817393 Patent:US5652358 Reaxys:28807 Patent:US5624824 PMID:3512560 PMID:8604341 PMID:2283377 Patent:US4990499 Wikipedia:Dihydrouridine PMID:4910242 PMID:8555190 PMID:19139092 HMDB:HMDB0000497 Patent:EP287128 Patent:WO2005112635 PMID:2692708 PMID:5572899 Patent:US4894364 PMID:22123979 Patent:US4017606 CAS:5627-05-4 PMID:12003496 PMID:8299222 Patent:US4210638 PMID:8774907 PMID:5139934 PMID:19488969 Patent:US5968914 |
| definition |
The uridine derivative obtained by formal hydrogenation of the endocyclic double bond in the uracil ring. |
| formula |
C9H14N2O6 |
| has role | |
| has_exact_synonym |
5,6-dihydrouridine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3,4-Dihydrouridine 1-beta-D-ribofuranosylhydrouracil D |
| id |
CHEBI:23774 |
| in_subset | |
| inchi |
InChI=1S/C9H14N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h4,6-8,12,14-15H,1-3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| inchikey |
ZPTBLXKRQACLCR-XVFCMESISA-N |
| label |
dihydrouridine |
| mass |
246.21730 |
| monoisotopicmass |
246.085 |
| notation |
CHEBI:23774 |
| prefLabel |
dihydrouridine |
| smiles |
OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1CCC(=O)NC1=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001228 | Sequence Types and Features Ontology | LOOM |