| Preferred Name |
FADH(.) |
| Synonyms |
flavin adenine dinucleotide semiquinone radical |
| ID |
http://purl.obolibrary.org/obo/CHEBI_30788 |
| charge |
0 |
| database_cross_reference |
Beilstein:4112594 |
| formula |
C27H34N9O15P2 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
flavin adenine dinucleotide semiquinone radical |
| id |
CHEBI:30788 |
| in_subset | |
| inchi |
InChI=1S/C27H34N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H2,33,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1 |
| inchikey |
KKQJCLIXDLBMNI-UYBVJOGSSA-N |
| label |
FADH(.) |
| mass |
786.55804 |
| monoisotopicmass |
786.165 |
| notation |
CHEBI:30788 |
| prefLabel |
FADH(.) |
| smiles |
Cc1cc2[N]c3c([nH]c(=O)[nH]c3=O)N(C[C@H](O)[C@H](O)[C@H](O)COP(O)(=O)OP(O)(=O)OC[C@H]3O[C@H]([C@H](O)[C@@H]3O)n3cnc4c(N)ncnc34)c2cc1C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/OGG_3000947594 | Ontology of Genes and Genomes | LOOM | |
| http://purl.obolibrary.org/obo/OGG_3000886053 | Ontology of Genes and Genomes | LOOM |