Preferred Name |
carvone |
Synonyms |
carvol 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one Carvon carvone 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one p-mentha-1(6),8-dien-2-one 1-carvone p-mentha-6,8-dien-2-one 2-methyl-5-isopropenyl-2-cyclohexenone 5-isopropenyl-2-methylcyclohex-2-en-1-one Karvon |
Definitions |
A p-menthane monoterpenoid that consists of cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
ID |
http://purl.obolibrary.org/obo/CHEBI_38265 |
charge |
0 |
database_cross_reference |
Wikipedia:Carvone PMID:16638680 Gmelin:102300 Reaxys:1364206 MetaCyc:Carvones PMID:19876560 PMID:20233552 PMID:21428701 Beilstein:1364206 CAS:99-49-0 |
definition |
A p-menthane monoterpenoid that consists of cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
formula |
C10H14O |
has_exact_synonym |
2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one carvone p-mentha-1(6),8-dien-2-one |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
carvol 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone Carvon 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one 1-carvone p-mentha-6,8-dien-2-one 2-methyl-5-isopropenyl-2-cyclohexenone 5-isopropenyl-2-methylcyclohex-2-en-1-one Karvon |
id |
CHEBI:38265 |
in_subset | |
inchi |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
inchikey |
ULDHMXUKGWMISQ-UHFFFAOYSA-N |
label |
carvone |
mass |
150.21756 |
monoisotopicmass |
150.104 |
notation |
CHEBI:38265 |
prefLabel |
carvone |
smiles |
CC(=C)C1CC=C(C)C(=O)C1 |
treeView | |
subClassOf |