loading...| Preferred Name |
N-acetyl-L-alanine |
| Synonyms |
L-N-Acetylalanine N-Acetylalanine N-acetyl-L-alpha-alanine Ac-Ala-OH N-Acetyl-S-alanine N-acetyl-L-alanine 2-Acetamidopropionic acid Acetylalanine (S)-2-(acetylamino)propanoic acid |
| Definitions |
An N-acetyl-L-amino acid that is L-alanine in which one of the hydrogens attached to the nitrogen is replaced by an acetyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_40992 |
| charge |
0 |
| database_cross_reference |
PDBeChem:AYA DrugBank:DB02518 PMID:50368 PMID:17439666 PMID:10794474 HMDB:HMDB0000766 CAS:97-69-8 Reaxys:1722932 PMID:16990931 |
| definition |
An N-acetyl-L-amino acid that is L-alanine in which one of the hydrogens attached to the nitrogen is replaced by an acetyl group. |
| formula |
C5H9NO3 |
| has role | |
| has_alternative_id |
CHEBI:21544 CHEBI:40986 |
| has_exact_synonym |
N-acetyl-L-alanine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
L-N-Acetylalanine N-Acetylalanine N-acetyl-L-alpha-alanine Ac-Ala-OH N-Acetyl-S-alanine 2-Acetamidopropionic acid Acetylalanine (S)-2-(acetylamino)propanoic acid |
| id |
CHEBI:40992 |
| in_subset | |
| inchi |
InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| inchikey |
KTHDTJVBEPMMGL-VKHMYHEASA-N |
| is conjugate acid of | |
| label |
N-acetyl-L-alanine |
| mass |
131.12990 |
| monoisotopicmass |
131.058 |
| notation |
CHEBI:40992 |
| prefLabel |
N-acetyl-L-alanine |
| smiles |
C[C@H](NC(C)=O)C(O)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/MOD_00050 | Protein Ontology | LOOM |