loading...| Preferred Name |
famciclovir |
| Synonyms |
FCV BRL-42810 famciclovir famciclovirum FAMCICLOVIR 2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate Famvir 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester |
| Definitions |
2-Amino-9H-purine in which the hydrogen at position 9 is substituted by a 4-acetoxy-3-(acetoxymethyl)but-1-yl group. A prodrug of the antiviral penciclovir, it is used for the treatment of acute herpes zoster (shingles), for the treatment or suppression of recurrent genital herpes in immunocompetent patients and for the treatment of recurrent mucocutaneous herpes simplex infections in HIV infected patients. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_4974 |
| charge |
0 |
| database_cross_reference |
PMID:17870541 Wikipedia:Famciclovir KEGG:D00317 PMID:9719596 CAS:104227-87-4 LINCS:LSM-2990 DrugBank:DB00426 Patent:US5246937 PMID:2754699 Reaxys:4208403 HMDB:HMDB0014570 Drug_Central:1128 |
| definition |
2-Amino-9H-purine in which the hydrogen at position 9 is substituted by a 4-acetoxy-3-(acetoxymethyl)but-1-yl group. A prodrug of the antiviral penciclovir, it is used for the treatment of acute herpes zoster (shingles), for the treatment or suppression of recurrent genital herpes in immunocompetent patients and for the treatment of recurrent mucocutaneous herpes simplex infections in HIV infected patients. |
| formula |
C14H19N5O4 |
| has role | |
| has_alternative_id |
CHEBI:174284 |
| has_exact_synonym |
FAMCICLOVIR 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
FCV BRL-42810 famciclovir famciclovirum 2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate Famvir 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester |
| id |
CHEBI:4974 |
| in_subset | |
| inchi |
InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| inchikey |
GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| label |
famciclovir |
| mass |
321.33180 |
| monoisotopicmass |
321.144 |
| notation |
CHEBI:4974 |
| prefLabel |
famciclovir |
| smiles |
CC(=O)OCC(CCn1cnc2cnc(N)nc12)COC(C)=O |
| treeView | |
| subClassOf |