loading...| Preferred Name |
Alexa Fluor 555 |
| Synonyms |
4-(6-amino-3-imino-4,5-disulfo-3H-xanthen-9-yl)benzene-1,3-dicarboxylic acid |
| Definitions |
A fluorescent dye of absorption wavelength 555 nm and emission wavelength 565 nm, derived from a 3,6-diaminoxanthene-4,5-disulfate. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_52673 |
| charge |
0 |
| definition |
A fluorescent dye of absorption wavelength 555 nm and emission wavelength 565 nm, derived from a 3,6-diaminoxanthene-4,5-disulfate. |
| formula |
C21H14N2O11S2 |
| has role | |
| has_exact_synonym |
4-(6-amino-3-imino-4,5-disulfo-3H-xanthen-9-yl)benzene-1,3-dicarboxylic acid |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:52673 |
| in_subset | |
| inchi |
InChI=1S/C21H14N2O11S2/c22-13-5-3-10-15(9-2-1-8(20(24)25)7-12(9)21(26)27)11-4-6-14(23)19(36(31,32)33)17(11)34-16(10)18(13)35(28,29)30/h1-7,22H,23H2,(H,24,25)(H,26,27)(H,28,29,30)(H,31,32,33) |
| inchikey |
IGAZHQIYONOHQN-UHFFFAOYSA-N |
| label |
Alexa Fluor 555 |
| mass |
534.47300 |
| monoisotopicmass |
534.004 |
| notation |
CHEBI:52673 |
| prefLabel |
Alexa Fluor 555 |
| smiles |
Nc1ccc2c(-c3ccc(cc3C(O)=O)C(O)=O)c3ccc(=N)c(c3oc2c1S(O)(=O)=O)S(O)(=O)=O |
| treeView | |
| subClassOf |