loading...| Preferred Name |
EDTA methidiumpropylamide |
| Synonyms |
[(carboxymethyl){2-[(carboxymethyl){2-[(3-{[4-(3,8-diamino-5-methylphenanthridinium-6-yl)phenyl]amino}propyl)amino]-2-oxoethyl}amino]ethyl}amino]acetate |
| Definitions |
A combined intercalating and chelating reagent. The iron chelate, prepared by adding Fe(NH4)2(SO4)2, effects random oxidative cleavage of DNA in the presence of O2 and a reducing agent. This activity is useful as a footprinting probe. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59056 |
| charge |
0 |
| definition |
A combined intercalating and chelating reagent. The iron chelate, prepared by adding Fe(NH4)2(SO4)2, effects random oxidative cleavage of DNA in the presence of O2 and a reducing agent. This activity is useful as a footprinting probe. |
| formula |
C33H39N7O7 |
| has role | |
| has_exact_synonym |
[(carboxymethyl){2-[(carboxymethyl){2-[(3-{[4-(3,8-diamino-5-methylphenanthridinium-6-yl)phenyl]amino}propyl)amino]-2-oxoethyl}amino]ethyl}amino]acetate |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:59056 |
| in_subset | |
| inchi |
InChI=1S/C33H39N7O7/c1-38-28-16-23(35)6-10-26(28)25-9-5-22(34)15-27(25)33(38)21-3-7-24(8-4-21)36-11-2-12-37-29(41)17-39(18-30(42)43)13-14-40(19-31(44)45)20-32(46)47/h3-10,15-16H,2,11-14,17-20,34H2,1H3,(H6,35,36,37,41,42,43,44,45,46,47) |
| inchikey |
PFGGLNMBUNROLG-UHFFFAOYSA-N |
| label |
EDTA methidiumpropylamide |
| mass |
645.70550 |
| monoisotopicmass |
645.291 |
| notation |
CHEBI:59056 |
| prefLabel |
EDTA methidiumpropylamide |
| smiles |
C[n+]1c(-c2ccc(NCCCNC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC(O)=O)cc2)c2cc(N)ccc2c2ccc(N)cc12 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_59056 | Ontology for Biomedical Investigations | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_59056 | Ontology for Biomedical Investigations | SAME_URI |