loading...| Preferred Name |
methamphetamine |
| Synonyms |
metamfetamine d-deoxyephedrine (alphaS)-N,alpha-dimethylbenzeneethanamine (2S)-N-methyl-1-phenylpropan-2-amine Methamphetamine d-N-methylamphetamine d-1-phenyl-2-methylaminopropane (S)-N,alpha-dimethylbenzeneethanamine d-desoxyephedrine metamfetaminum metanfetamina (+)-(S)-N-alpha-dimethylphenethylamine dextromethamphetamine d-phenylisopropylmethylamine methyl-beta-phenylisopropylamine |
| Definitions |
A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_6809 |
| charge |
0 |
| database_cross_reference |
PMID:15542724 PMID:11831503 PMID:15380623 PMID:11984857 PMID:18521756 PMID:11711870 PMID:14645148 PMID:19732271 PMID:19576287 PMID:19384581 PMID:15542728 KEGG:C07164 PMID:18279499 PMID:26775284 PMID:18991860 PMID:18509037 PMID:27232669 Drug_Central:1732 PMID:14769818 PMID:11847428 Reaxys:2207147 PMID:11829406 KEGG:D08187 PMID:11717374 PMID:25724762 PMID:15808793 PMID:26568405 PMID:11221576 PMID:19269222 PMID:26992824 PMID:18991862 CAS:537-46-2 PMID:11406298 PDBeChem:B40 PMID:26302754 Wikipedia:Methamphetamine PMID:11896153 PMID:26541330 DrugBank:DB01577 HMDB:HMDB0015517 PMID:24349338 PMID:26683901 Beilstein:2207147 |
| definition |
A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. |
| formula |
C10H15N |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50910 http://purl.obolibrary.org/obo/CHEBI_78298 |
| has_exact_synonym |
(2S)-N-methyl-1-phenylpropan-2-amine Methamphetamine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
metamfetamine d-deoxyephedrine (alphaS)-N,alpha-dimethylbenzeneethanamine d-N-methylamphetamine d-1-phenyl-2-methylaminopropane (S)-N,alpha-dimethylbenzeneethanamine d-desoxyephedrine metamfetaminum metanfetamina (+)-(S)-N-alpha-dimethylphenethylamine dextromethamphetamine d-phenylisopropylmethylamine methyl-beta-phenylisopropylamine |
| id |
CHEBI:6809 |
| in_subset | |
| inchi |
InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1 |
| inchikey |
MYWUZJCMWCOHBA-VIFPVBQESA-N |
| is conjugate base of | |
| label |
methamphetamine |
| mass |
149.23284 |
| monoisotopicmass |
149.120 |
| notation |
CHEBI:6809 |
| prefLabel |
methamphetamine |
| smiles |
CN[C@@H](C)Cc1ccccc1 |
| treeView | |
| subClassOf |