| Preferred Name |
pantothenic acid |
| Synonyms |
3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine Pantothenic acid |
| Definitions |
A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_7916 |
| charge |
0 |
| database_cross_reference |
Reaxys:1727062 DrugBank:DB01783 Wikipedia:Pantothenic_acid CAS:599-54-2 KEGG:D07413 PMID:24727172 KEGG:C00864 Beilstein:1727062 HMDB:HMDB0000210 |
| definition |
A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
| formula |
C9H17NO5 |
| has role | |
| has_exact_synonym |
3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid Pantothenic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine |
| id |
CHEBI:7916 |
| in_subset | |
| inchi |
InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) |
| inchikey |
GHOKWGTUZJEAQD-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
pantothenic acid |
| mass |
219.23502 |
| monoisotopicmass |
219.111 |
| notation |
CHEBI:7916 |
| prefLabel |
pantothenic acid |
| smiles |
CC(C)(CO)C(O)C(=O)NCCC(O)=O |
| treeView | |
| subClassOf |