loading...| Preferred Name |
prednisone |
| Synonyms |
1,2-Dehydrocortisone 17,21-Dihydroxypregna-1,4-diene-3,11,20-trione prednisona prednison 1,4-Pregnadiene-17alpha,21-diol-3,11,20-trione prednisonum 17,21-dihydroxypregna-1,4-diene-3,11,20-trione prednisone Dehydrocortisone |
| Definitions |
A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a beta-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_8382 |
| charge |
0 |
| database_cross_reference |
DrugBank:DB00635 Patent:US2579479 PMID:10438974 CAS:53-03-2 Drug_Central:2253 PMID:23093541 KEGG:C07370 Reaxys:2065301 Patent:US2837464 Patent:US2897216 PMID:15859934 Beilstein:2065301 PMID:23395281 PMID:18971570 Patent:US3134718 Wikipedia:Prednisone |
| definition |
A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a beta-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid. |
| formula |
C21H26O5 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_50266 http://purl.obolibrary.org/obo/CHEBI_35610 |
| has_exact_synonym |
17,21-dihydroxypregna-1,4-diene-3,11,20-trione |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
1,2-Dehydrocortisone 17,21-Dihydroxypregna-1,4-diene-3,11,20-trione prednisona prednison 1,4-Pregnadiene-17alpha,21-diol-3,11,20-trione prednisonum prednisone Dehydrocortisone |
| id |
CHEBI:8382 |
| in_subset | |
| inchi |
InChI=1S/C21H26O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
| inchikey |
XOFYZVNMUHMLCC-ZPOLXVRWSA-N |
| label |
prednisone |
| mass |
358.42810 |
| monoisotopicmass |
358.178 |
| notation |
CHEBI:8382 |
| prefLabel |
prednisone |
| smiles |
[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])C(=O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_139592 http://purl.obolibrary.org/obo/CHEBI_47787 http://purl.obolibrary.org/obo/CHEBI_77166 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35342 http://purl.obolibrary.org/obo/CHEBI_35344 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139592 http://purl.obolibrary.org/obo/CHEBI_47787 http://purl.obolibrary.org/obo/CHEBI_77166 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35342 http://purl.obolibrary.org/obo/CHEBI_35344 |