loading...| Preferred Name |
digoxin |
| Synonyms |
12beta-hydroxydigitoxin (3beta,5beta,12beta)-3-{[2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl]oxy}-12,14-dihydroxycard-20(22)-enolide digoxin |
| Definitions |
A cardenolide glycoside that is digitoxin beta-hydroxylated at C-12. A cardiac glycoside extracted from the foxglove plant, Digitalis lanata, it is used to control ventricular rate in atrial fibrillation and in the management of congestive heart failure with atrial fibrillation, but the margin between toxic and therapeutic doses is small. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_4551 |
| charge |
0 |
| chemical inhibits in vitro replication of virus | |
| chemical inhibits protein | |
| database_cross_reference |
PMID:10438974 PDBeChem:DGX PMID:8234291 KEGG:C06956 PDB:1IGJ Wikipedia:Digoxin PMID:16970134 Beilstein:77011 KEGG:D00298 KNApSAcK:C00003618 Drug_Central:882 PMID:7739045 CAS:20830-75-5 DrugBank:DB00390 Reaxys:77011 |
| definition source |
https://www.drugbank.ca/drugs/DB00390 PMID: 32366720 |
| formula |
C41H64O14 |
| has exact synonym |
(3beta,5beta,12beta)-3-{[2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl]oxy}-12,14-dihydroxycard-20(22)-enolide |
| has role |
http://purl.obolibrary.org/obo/CHEBI_53000 http://purl.obolibrary.org/obo/CHEBI_63510 |
| has_alternative_id |
CHEBI:569365 CHEBI:616935 CHEBI:41856 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
12beta-hydroxydigitoxin digoxin |
| id |
CHEBI:4551 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C41H64O14/c1-19-36(47)28(42)15-34(50-19)54-38-21(3)52-35(17-30(38)44)55-37-20(2)51-33(16-29(37)43)53-24-8-10-39(4)23(13-24)6-7-26-27(39)14-31(45)40(5)25(9-11-41(26,40)48)22-12-32(46)49-18-22/h12,19-21,23-31,33-38,42-45,47-48H,6-11,13-18H2,1-5H3/t19-,20-,21-,23-,24+,25-,26-,27+,28+,29+,30+,31-,33+,34+,35+,36-,37-,38-,39+,40+,41+/m1/s1 |
| inchikey |
LTMHDMANZUZIPE-PUGKRICDSA-N |
| is conjugate acid of | |
| label |
digoxin |
| mass |
780.93850 |
| monoisotopicmass |
780.42961 |
| notation |
CHEBI:4551 |
| prefLabel |
digoxin |
| smiles |
[H][C@]12CC[C@]3([H])[C@]([H])(C[C@@H](O)[C@]4(C)[C@H](CC[C@]34O)C3=CC(=O)OC3)[C@@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@H](O[C@H]2C[C@H](O)[C@H](O[C@H]3C[C@H](O)[C@H](O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1 |
| textual definition |
A cardenolide glycoside that is digitoxin beta-hydroxylated at C-12. A cardiac glycoside extracted from the foxglove plant, Digitalis lanata, it is used to control ventricular rate in atrial fibrillation and in the management of congestive heart failure with atrial fibrillation, but the margin between toxic and therapeutic doses is small. |
| subClassOf |