loading...| Preferred Name |
2'-alpha-mannosyl-L-tryptophan |
| Synonyms |
2'-tryptophan C-mannoside 2'-alpha-mannosyltryptophan C(2)-alpha-D-mannopyranosyl-L-tryptophan (1R)-1,5-anhydro-1-{3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-2-yl}-D-mannitol 2'-alpha-D-mannosyltryptophan 2'-alpha-D-mannosyl-L-tryptophan |
| Definitions |
A C-glycosyl compound that is L-tryptophan in which the hydrogen at position 2 on the indole protion has been replaced by an alpha-mannosyl residue. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_19232 |
| charge |
0 |
| database_cross_reference |
Reaxys:8450900 |
| definition |
A C-glycosyl compound that is L-tryptophan in which the hydrogen at position 2 on the indole protion has been replaced by an alpha-mannosyl residue. |
| formula |
C17H22N2O7 |
| has functional parent | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2'-tryptophan C-mannoside 2'-alpha-mannosyltryptophan C(2)-alpha-D-mannopyranosyl-L-tryptophan (1R)-1,5-anhydro-1-{3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-2-yl}-D-mannitol 2'-alpha-D-mannosyltryptophan 2'-alpha-D-mannosyl-L-tryptophan |
| id |
CHEBI:19232 |
| in_subset | |
| inchi |
InChI=1S/C17H22N2O7/c18-9(17(24)25)5-8-7-3-1-2-4-10(7)19-12(8)16-15(23)14(22)13(21)11(6-20)26-16/h1-4,9,11,13-16,19-23H,5-6,18H2,(H,24,25)/t9-,11+,13+,14-,15-,16+/m0/s1 |
| inchikey |
CPXSBHKDEPPWIX-RAYCSJGISA-N |
| is tautomer of | |
| label |
2'-alpha-mannosyl-L-tryptophan |
| mass |
366.366 |
| monoisotopicmass |
366.143 |
| notation |
CHEBI:19232 |
| prefLabel |
2'-alpha-mannosyl-L-tryptophan |
| smiles |
O1[C@@H]([C@H]([C@H]([C@@H]([C@H]1CO)O)O)O)C2=C(C3=C(N2)C=CC=C3)C[C@@H](C(=O)O)N |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/MOD_00222 | Protein Ontology | LOOM |