| Preferred Name |
N(2),N(2)-dimethylguanosine |
| Synonyms |
N(2),N(2)-Dimethylguanosine N2-Dimethylguanosine 2,2-dimethylguanosine m22g 2-Dimethylamino-6-oxypurine riboside 2-(dimethylamino)-9-(beta-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-one N,N-dimethylguanosine |
| Definitions |
A guanosine where the hydrogens of the amine group at C-2 are substituted by methyl groups. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_19289 |
| charge |
0 |
| database_cross_reference |
PMID:22770225 CAS:2140-67-2 HMDB:HMDB0004824 Reaxys:47545 Beilstein:47545 |
| definition |
A guanosine where the hydrogens of the amine group at C-2 are substituted by methyl groups. |
| formula |
C12H17N5O5 |
| has role | |
| has_exact_synonym |
N(2),N(2)-Dimethylguanosine N,N-dimethylguanosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N2-Dimethylguanosine 2,2-dimethylguanosine m22g 2-Dimethylamino-6-oxypurine riboside 2-(dimethylamino)-9-(beta-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-one |
| id |
CHEBI:19289 |
| in_subset | |
| inchi |
InChI=1S/C12H17N5O5/c1-16(2)12-14-9-6(10(21)15-12)13-4-17(9)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,18-20H,3H2,1-2H3,(H,14,15,21)/t5-,7-,8-,11-/m1/s1 |
| inchikey |
RSPURTUNRHNVGF-IOSLPCCCSA-N |
| label |
N(2),N(2)-dimethylguanosine |
| mass |
311.29408 |
| monoisotopicmass |
311.123 |
| notation |
CHEBI:19289 |
| prefLabel |
N(2),N(2)-dimethylguanosine |
| smiles |
CN(C)c1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001328 | Sequence Types and Features Ontology | LOOM | |
| http://purl.bioontology.org/ontology/MESH/C008940 | Medical Subject Headings | LOOM |