loading...| Preferred Name |
N-ethyl-N-nitrosourea |
| Synonyms |
N-Ethyl-N-nitroso-urea 1-ethyl-1-nitrosourea ENU 1-Ethyl-1-nitrosourea NEU Ethyl nitrosourea N-Ethylnitrosourea N-Ethyl-N-nitroso carbamide 1-(Aminocarbonyl)-1-ethyl-2-oxohydrazine Aethylnitroso-harnstoff |
| Definitions |
A member of the class of N-nitrosoureas that is urea in which one of the nitrogens is substituted by ethyl and nitroso groups. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_23995 |
| charge |
0 |
| database_cross_reference |
PMID:11853764 PMID:11732210 PMID:11880538 PMID:22012195 Beilstein:1761174 PMID:21861612 KEGG:C19178 PMID:23551873 PMID:24175309 Reaxys:1761174 PMID:16423555 CAS:759-73-9 Wikipedia:ENU PMID:22238669 PMID:8603364 |
| definition |
A member of the class of N-nitrosoureas that is urea in which one of the nitrogens is substituted by ethyl and nitroso groups. |
| formula |
C3H7N3O2 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_25435 http://purl.obolibrary.org/obo/CHEBI_22333 |
| has_exact_synonym |
1-ethyl-1-nitrosourea |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N-Ethyl-N-nitroso-urea ENU 1-Ethyl-1-nitrosourea NEU Ethyl nitrosourea N-Ethylnitrosourea N-Ethyl-N-nitroso carbamide 1-(Aminocarbonyl)-1-ethyl-2-oxohydrazine Aethylnitroso-harnstoff |
| id |
CHEBI:23995 |
| in_subset | |
| inchi |
InChI=1S/C3H7N3O2/c1-2-6(5-8)3(4)7/h2H2,1H3,(H2,4,7) |
| inchikey |
FUSGACRLAFQQRL-UHFFFAOYSA-N |
| label |
N-ethyl-N-nitrosourea |
| mass |
117.10660 |
| monoisotopicmass |
117.054 |
| notation |
CHEBI:23995 |
| prefLabel |
N-ethyl-N-nitrosourea |
| smiles |
CCN(N=O)C(N)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_23995 | Ontology for Biomedical Investigations | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_23995 | Ontology for Biomedical Investigations | SAME_URI |