loading...| Preferred Name |
heroin |
| Synonyms |
O,O'-Diacetylmorphine Heroin 3,6-Diacetylmorphine 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diyl diacetate (5alpha,6alpha)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) Diacetylmorphine Diamorphine |
| Definitions |
A morphinane alkaloid that is morphine bearing two acetyl substituents on the O-3 and O-6 positions. As with other opioids, heroin is used as both an analgesic and a recreational drug. Frequent and regular administration is associated with tolerance and physical dependence, which may develop into addiction. Its use includes treatment for acute pain, such as in severe physical trauma, myocardial infarction, post-surgical pain, and chronic pain, including end-stage cancer and other terminal illnesses. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_27808 |
| charge |
0 |
| database_cross_reference |
PMID:11441925 PMID:11448454 PMID:21608377 CAS:561-27-3 PMID:12965116 PMID:15212982 PMID:15550572 PMID:21235340 Reaxys:99261 PMID:16076083 PMID:21740578 PMID:15772255 Wikipedia:Heroin PMID:15843500 PMID:20855171 PMID:21568984 PMID:20649590 PMID:21452028 PMID:21362452 PMID:15213301 PMID:10454516 PMID:21527184 KEGG:D07286 PMID:8858977 PMID:21309955 PMID:20331562 PMID:2352148 DrugBank:DB01452 PMID:20735218 PMID:8893832 Drug_Central:4412 PMID:21734607 PMID:14534521 PMID:9918543 PMID:11557911 PMID:20810225 PMID:16333714 KEGG:C06534 |
| definition |
A morphinane alkaloid that is morphine bearing two acetyl substituents on the O-3 and O-6 positions. As with other opioids, heroin is used as both an analgesic and a recreational drug. Frequent and regular administration is associated with tolerance and physical dependence, which may develop into addiction. Its use includes treatment for acute pain, such as in severe physical trauma, myocardial infarction, post-surgical pain, and chronic pain, including end-stage cancer and other terminal illnesses. |
| formula |
C21H23NO5 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_50266 |
| has_alternative_id |
CHEBI:24528 CHEBI:5680 |
| has_exact_synonym |
Heroin 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diyl diacetate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
O,O'-Diacetylmorphine 3,6-Diacetylmorphine 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate (5alpha,6alpha)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) Diacetylmorphine Diamorphine |
| id |
CHEBI:27808 |
| in_subset | |
| inchi |
InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| inchikey |
GVGLGOZIDCSQPN-PVHGPHFFSA-N |
| label |
heroin |
| mass |
369.41100 |
| monoisotopicmass |
369.158 |
| notation |
CHEBI:27808 |
| prefLabel |
heroin |
| smiles |
[H][C@]12C=C[C@H](OC(C)=O)[C@@H]3Oc4c(OC(C)=O)ccc5C[C@H]1N(C)CC[C@@]23c45 |
| treeView | |
| subClassOf |