loading...| Preferred Name |
N(6),N(6)-dimethyladenosine |
| Synonyms |
6-Dimethylaminopurine D-riboside N(6),N(6)-Dimethyladenosine 6-Dimethyladenosine N,N-dimethyladenosine 6-N-Dimethyladenosine 6-(Dimethylamino)purine ribonucleoside N,N-Dimethyladenosine 6-(Dimethylamino)purine riboside N6-Dimethyladenosine N6,N6-Dimethyladenosine |
| Definitions |
A methyladenosine compound with two methyl groups attached to N(6) of the adenine nucleobase. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28284 |
| charge |
0 |
| database_cross_reference |
Beilstein:93906 CAS:2620-62-4 PMID:323854 KEGG:C03416 PDBeChem:26A |
| definition |
A methyladenosine compound with two methyl groups attached to N(6) of the adenine nucleobase. |
| formula |
C12H17N5O4 |
| has functional parent | |
| has_alternative_id |
CHEBI:7404 CHEBI:21856 |
| has_exact_synonym |
N(6),N(6)-Dimethyladenosine N,N-dimethyladenosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
6-Dimethylaminopurine D-riboside 6-Dimethyladenosine 6-N-Dimethyladenosine 6-(Dimethylamino)purine ribonucleoside N,N-Dimethyladenosine 6-(Dimethylamino)purine riboside N6-Dimethyladenosine N6,N6-Dimethyladenosine |
| id |
CHEBI:28284 |
| in_subset | |
| inchi |
InChI=1S/C12H17N5O4/c1-16(2)10-7-11(14-4-13-10)17(5-15-7)12-9(20)8(19)6(3-18)21-12/h4-6,8-9,12,18-20H,3H2,1-2H3/t6-,8-,9-,12-/m1/s1 |
| inchikey |
WVGPGNPCZPYCLK-WOUKDFQISA-N |
| label |
N(6),N(6)-dimethyladenosine |
| mass |
295.29450 |
| monoisotopicmass |
295.128 |
| notation |
CHEBI:28284 |
| prefLabel |
N(6),N(6)-dimethyladenosine |
| smiles |
CN(C)c1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001311 | Sequence Types and Features Ontology | LOOM | |
| http://purl.bioontology.org/ontology/MESH/C021013 | Medical Subject Headings | LOOM |