| Preferred Name |
diethyl pyrocarbonate |
| Synonyms |
Diethyl pyrocarbonic acid Pyrocarbonic acid diethyl ester diethyl dicarbonate Oxydiformic acid diethyl ester Ethyl pyrocarbonate Diethyl oxydiformate Diethyl pyrocarbonate Pyrocarbonate d'ethyle Pyrokohlensaeure diaethyl ester Dicarbonic acid diethyl ester |
| Definitions |
The diethyl ester of dicarbonic acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59051 |
| charge |
0 |
| database_cross_reference |
Beilstein:637031 Gmelin:602268 CAS:1609-47-8 KEGG:C11592 |
| definition |
The diethyl ester of dicarbonic acid. |
| formula |
C6H10O5 |
| has functional parent | |
| has_alternative_id |
CHEBI:4525 |
| has_exact_synonym |
diethyl dicarbonate Diethyl pyrocarbonate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Diethyl pyrocarbonic acid Pyrocarbonic acid diethyl ester Oxydiformic acid diethyl ester Ethyl pyrocarbonate Diethyl oxydiformate Pyrocarbonate d'ethyle Pyrokohlensaeure diaethyl ester Dicarbonic acid diethyl ester |
| id |
CHEBI:59051 |
| in_subset | |
| inchi |
InChI=1S/C6H10O5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3 |
| inchikey |
FFYPMLJYZAEMQB-UHFFFAOYSA-N |
| label |
diethyl pyrocarbonate |
| mass |
162.14060 |
| monoisotopicmass |
162.053 |
| notation |
CHEBI:59051 |
| prefLabel |
diethyl pyrocarbonate |
| smiles |
CCOC(=O)OC(=O)OCC |
| treeView | |
| subClassOf |