loading...| Preferred Name |
1,1-dihydroxy-3-ethoxy-2-butanone |
| Synonyms |
3-Ethoxy-1,1-dihydroxy-2-butanone ketoxalum kethoxal beta-Ethoxy-alpha-ketobutyraldehyde 3-ethoxy-1,1-dihydroxybutan-2-one Chetossale |
| Definitions |
A butanone derivative having two hydroxy substituents at the 1-position and an ethoxy substituent at the 3-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59052 |
| charge |
0 |
| database_cross_reference |
KEGG:D04651 Beilstein:8677948 Drug_Central:3202 CAS:27762-78-3 |
| definition |
A butanone derivative having two hydroxy substituents at the 1-position and an ethoxy substituent at the 3-position. |
| formula |
C6H12O4 |
| has role | |
| has_exact_synonym |
3-ethoxy-1,1-dihydroxybutan-2-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3-Ethoxy-1,1-dihydroxy-2-butanone ketoxalum kethoxal beta-Ethoxy-alpha-ketobutyraldehyde Chetossale |
| id |
CHEBI:59052 |
| in_subset | |
| inchi |
InChI=1S/C6H12O4/c1-3-10-4(2)5(7)6(8)9/h4,6,8-9H,3H2,1-2H3 |
| inchikey |
YRCRRHNVYVFNTM-UHFFFAOYSA-N |
| label |
1,1-dihydroxy-3-ethoxy-2-butanone |
| mass |
148.15710 |
| monoisotopicmass |
148.074 |
| notation |
CHEBI:59052 |
| prefLabel |
1,1-dihydroxy-3-ethoxy-2-butanone |
| smiles |
CCOC(C)C(=O)C(O)O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_59052 | Ontology for Biomedical Investigations | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_59052 | Ontology for Biomedical Investigations | SAME_URI |