| Preferred Name |
N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide |
| Synonyms |
N-cyclohexyl-N'-(2-morpholin-4-ylethyl)methanediimine 1-Cmec CMCT 1-Cyclohexyl-3-(2-(4-morpholinyl)ethyl)carbodiimide N-cyclohexyl-N'-[2-(morpholin-4-yl)ethyl]carbodiimide |
| Definitions |
A carbodiimide having cyclcohexyl and 2-(4-morpholinyl)ethyl as the two N-substituents. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59053 |
| charge |
0 |
| database_cross_reference |
Beilstein:196522 CAS:15580-20-8 |
| definition |
A carbodiimide having cyclcohexyl and 2-(4-morpholinyl)ethyl as the two N-substituents. |
| formula |
C13H23N3O |
| has role | |
| has_exact_synonym |
N-cyclohexyl-N'-[2-(morpholin-4-yl)ethyl]carbodiimide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N-cyclohexyl-N'-(2-morpholin-4-ylethyl)methanediimine 1-Cmec CMCT 1-Cyclohexyl-3-(2-(4-morpholinyl)ethyl)carbodiimide |
| id |
CHEBI:59053 |
| in_subset | |
| inchi |
InChI=1S/C13H23N3O/c1-2-4-13(5-3-1)15-12-14-6-7-16-8-10-17-11-9-16/h13H,1-11H2 |
| inchikey |
XNPOFXIBHOVFFH-UHFFFAOYSA-N |
| label |
N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide |
| mass |
237.34120 |
| monoisotopicmass |
237.184 |
| notation |
CHEBI:59053 |
| prefLabel |
N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide |
| smiles |
C1CCC(CC1)N=C=NCCN1CCOCC1 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_59053 | Ontology for Biomedical Investigations | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_59053 | Ontology for Biomedical Investigations | SAME_URI |