loading...| Preferred Name |
queuosine |
| Synonyms |
2-amino-5-({[(1S,4S,5R)-4,5-dihydroxycyclopent-2-en-1-yl]amino}methyl)-7-(beta-D-ribofuranosyl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one Nucleoside Q Q (nucleoside) q |
| Definitions |
A nucleoside found in tRNA that has an additional cyclopentenyl ring added via an NH group to the methyl group of 7-methyl-7-deazaguanosine. The cyclopentenyl ring may carry other substituents. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_60193 |
| charge |
0 |
| database_cross_reference |
PMID:19414587 HMDB:HMDB0011596 PMID:20333371 PMID:21487017 CAS:57072-36-3 PMID:19285444 PMID:19925456 PMID:388227 |
| definition |
A nucleoside found in tRNA that has an additional cyclopentenyl ring added via an NH group to the methyl group of 7-methyl-7-deazaguanosine. The cyclopentenyl ring may carry other substituents. |
| formula |
C17H23N5O7 |
| has_exact_synonym |
2-amino-5-({[(1S,4S,5R)-4,5-dihydroxycyclopent-2-en-1-yl]amino}methyl)-7-(beta-D-ribofuranosyl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Nucleoside Q Q (nucleoside) q |
| id |
CHEBI:60193 |
| in_subset | |
| inchi |
InChI=1S/C17H23N5O7/c18-17-20-14-10(15(28)21-17)6(3-19-7-1-2-8(24)11(7)25)4-22(14)16-13(27)12(26)9(5-23)29-16/h1-2,4,7-9,11-13,16,19,23-27H,3,5H2,(H3,18,20,21,28)/t7-,8-,9+,11+,12+,13+,16+/m0/s1 |
| inchikey |
QQXQGKSPIMGUIZ-AEZJAUAXSA-N |
| label |
queuosine |
| mass |
409.39380 |
| monoisotopicmass |
409.160 |
| notation |
CHEBI:60193 |
| prefLabel |
queuosine |
| smiles |
Nc1nc2n(cc(CN[C@H]3C=C[C@H](O)[C@@H]3O)c2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001317 | Sequence Types and Features Ontology | LOOM |