| Preferred Name |
archaeosine |
| Synonyms |
G* 2-amino-4-oxo-7-(beta-D-ribofuranosyl)-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide 7-formamidino-7-deazaguanosine |
| Definitions |
A 7-deazaguanine ribonucleoside having 7-formamidino-7-deazaguanine as the nucleobase. It is found in the majority of archaeal tRNAs specifically at position 15 of the dihydrouridine loop (D-loop), a position not modified in either eukaryotic or bacterial tRNA. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_73271 |
| charge |
0 |
| database_cross_reference |
Reaxys:18583543 PMID:21999246 PMID:23201278 PMID:9242689 PMID:18004462 MetaCyc:CPD-13057 CAS:148608-52-0 PMID:22032275 |
| definition |
A 7-deazaguanine ribonucleoside having 7-formamidino-7-deazaguanine as the nucleobase. It is found in the majority of archaeal tRNAs specifically at position 15 of the dihydrouridine loop (D-loop), a position not modified in either eukaryotic or bacterial tRNA. |
| formula |
C12H16N6O5 |
| has functional parent | |
| has_exact_synonym |
2-amino-4-oxo-7-(beta-D-ribofuranosyl)-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
G* 7-formamidino-7-deazaguanosine |
| id |
CHEBI:73271 |
| in_subset | |
| inchi |
InChI=1S/C12H16N6O5/c13-8(14)3-1-18(9-5(3)10(22)17-12(15)16-9)11-7(21)6(20)4(2-19)23-11/h1,4,6-7,11,19-21H,2H2,(H3,13,14)(H3,15,16,17,22)/t4-,6-,7-,11-/m1/s1 |
| inchikey |
PEMQXWCOMFJRLS-RPKMEZRRSA-N |
| label |
archaeosine |
| mass |
324.29260 |
| monoisotopicmass |
324.118 |
| notation |
CHEBI:73271 |
| prefLabel |
archaeosine |
| smiles |
NC(=N)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c12 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C081066 | Medical Subject Headings | LOOM | |
| http://purl.obolibrary.org/obo/SO_0001323 | Sequence Types and Features Ontology | LOOM |