| Preferred Name |
retinal |
| Synonyms |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal retinal |
| Definitions |
An enal that consists of 3,7-dimethyl-9-nona-2,4,6,8-tetraenal (double bond geometry unspecified) carrying a 2,6,6-trimethylcyclohex-1-en-1-yl group at the 9-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_15035 |
| charge |
0 |
| database_cross_reference |
MetaCyc:Retinals Reaxys:2055098 |
| definition |
An enal that consists of 3,7-dimethyl-9-nona-2,4,6,8-tetraenal (double bond geometry unspecified) carrying a 2,6,6-trimethylcyclohex-1-en-1-yl group at the 9-position. |
| formula |
C20H28O |
| has role | |
| has_exact_synonym |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal retinal |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:15035 |
| in_subset | |
| inchi |
InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3 |
| inchikey |
NCYCYZXNIZJOKI-UHFFFAOYSA-N |
| label |
retinal |
| mass |
284.43572 |
| monoisotopicmass |
284.214 |
| notation |
CHEBI:15035 |
| prefLabel |
retinal |
| smiles |
[H]C(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| treeView | |
| subClassOf |