Preferred Name |
ATP |
Synonyms |
adenosine 5'-(tetrahydrogen triphosphate) Adenosine 5'-triphosphate ATP H4atp Adenosine triphosphate ADENOSINE-5'-TRIPHOSPHATE |
Definitions |
An adenosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. It is involved in the transportation of chemical energy during metabolic pathways. |
ID |
http://purl.obolibrary.org/obo/CHEBI_15422 |
charge |
0 |
database_cross_reference |
Reaxys:73010 Beilstein:73010 KEGG:D08646 PDBeChem:ATP Gmelin:34857 DrugBank:DB00171 CAS:56-65-5 Patent:US3079379 Wikipedia:Adenosine_triphosphate Drug_Central:91 KNApSAcK:C00001491 HMDB:HMDB0000538 KEGG:C00002 |
definition |
An adenosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. It is involved in the transportation of chemical energy during metabolic pathways. |
formula |
C10H16N5O13P3 |
has role |
http://purl.obolibrary.org/obo/CHEBI_27027 |
has_alternative_id |
CHEBI:22249 CHEBI:10789 CHEBI:13236 CHEBI:40938 CHEBI:2359 CHEBI:10841 |
has_exact_synonym |
adenosine 5'-(tetrahydrogen triphosphate) ATP |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
Adenosine 5'-triphosphate H4atp Adenosine triphosphate ADENOSINE-5'-TRIPHOSPHATE |
id |
CHEBI:15422 |
in_subset | |
inchi |
InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
inchikey |
ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
is conjugate acid of | |
label |
ATP |
mass |
507.18100 |
monoisotopicmass |
506.996 |
notation |
CHEBI:15422 |
prefLabel |
ATP |
smiles |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O |
treeView | |
subClassOf |