| Preferred Name |
sphingosine |
| Synonyms |
sphingosin (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-ene-1-ol (4E)-sphing-4-enine (2S,3R,E)-2-aminooctadec-4-ene-1,3-diol (2S,3R)-(E)-2-amino-1,3-dihydroxy-4-octadecene Sph D-erythro-sphingosine D-(+)-erythro-1,3-dihydroxy-2-amino-4-trans-octadecene Sphingenine (E)-D-erythro-4-octadecene-1,3-diol Sphingosine d18:1 trans-4-sphingenine 2-amino-4-octadecene-1,3-diol Sphing-4-enine C18 sphingosine Sphingoid trans-D-erythro-2-amino-4-octadecene-1,3-diol (4E)-sphingenine Sphingosine (2S,3R,4E)-2-amino-4-octadecene-1,3-diol (2S,3R,4E)-2-aminooctadec-4-ene-1,3-diol (E)-2-amino-4-octadecan-1,3-diol |
| Definitions |
A sphing-4-enine in which the double bond is trans. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16393 |
| charge |
0 |
| database_cross_reference |
LIPID_MAPS_instance:LMSP01010001 PMID:8482346 Reaxys:1727294 KEGG:C00319 DrugBank:DB03203 CAS:123-78-4 Beilstein:1727294 PMID:16341241 Beilstein:4676153 PMID:10453988 PMID:24731183 PDBeChem:SQS HMDB:HMDB0000252 |
| definition |
A sphing-4-enine in which the double bond is trans. |
| formula |
C18H37NO2 |
| has role | |
| has_alternative_id |
CHEBI:26741 CHEBI:9224 CHEBI:15102 CHEBI:207585 |
| has_exact_synonym |
Sphingosine (2S,3R,4E)-2-aminooctadec-4-ene-1,3-diol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
sphingosin (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-ene-1-ol (4E)-sphing-4-enine (2S,3R,E)-2-aminooctadec-4-ene-1,3-diol (2S,3R)-(E)-2-amino-1,3-dihydroxy-4-octadecene Sph D-erythro-sphingosine D-(+)-erythro-1,3-dihydroxy-2-amino-4-trans-octadecene Sphingenine (E)-D-erythro-4-octadecene-1,3-diol Sphingosine d18:1 trans-4-sphingenine 2-amino-4-octadecene-1,3-diol Sphing-4-enine C18 sphingosine Sphingoid trans-D-erythro-2-amino-4-octadecene-1,3-diol (4E)-sphingenine (2S,3R,4E)-2-amino-4-octadecene-1,3-diol (E)-2-amino-4-octadecan-1,3-diol |
| id |
CHEBI:16393 |
| in_subset | |
| inchi |
InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m0/s1 |
| inchikey |
WWUZIQQURGPMPG-KRWOKUGFSA-N |
| is conjugate base of | |
| is enantiomer of | |
| label |
sphingosine |
| mass |
299.49190 |
| monoisotopicmass |
299.282 |
| notation |
CHEBI:16393 |
| prefLabel |
sphingosine |
| smiles |
CCCCCCCCCCCCCC=C\[C@@H](O)[C@@H](N)CO |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_16393 | Human Phenotype Ontology China | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_16393 | Human Phenotype Ontology China | SAME_URI | |
| http://purl.bioontology.org/ontology/MESH/D013110 | Medical Subject Headings | LOOM |