| Preferred Name |
serine |
| Synonyms |
2-amino-3-hydroxypropanoic acid Serine serine 3-Hydroxyalanine 2-Amino-3-hydroxypropionic acid Serin |
| Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Serine Gmelin:26429 KEGG:C00716 Beilstein:1721402 KNApSAcK:C00001393 Reaxys:1721402 CAS:302-84-1 |
| definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
| formula |
C3H7NO3 |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:15081 CHEBI:9116 CHEBI:26648 |
| has_exact_synonym |
Serine serine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-amino-3-hydroxypropanoic acid 3-Hydroxyalanine 2-Amino-3-hydroxypropionic acid Serin |
| id |
CHEBI:17822 |
| in_subset | |
| inchi |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
| inchikey |
MTCFGRXMJLQNBG-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| is tautomer of | |
| label |
serine |
| mass |
105.09262 |
| monoisotopicmass |
105.043 |
| notation |
CHEBI:17822 |
| prefLabel |
serine |
| smiles |
NC(CO)C(O)=O |
| treeView | |
| subClassOf |