| Preferred Name |
tyrosine |
| Synonyms |
Tyrosine tirosina 2-amino-3-(4-hydroxyphenyl)propanoic acid Y Tyr tyrosine 3-(p-Hydroxyphenyl)alanine 2-Amino-3-(p-hydroxyphenyl)propionic acid Tyrosin |
| Definitions |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_18186 |
| charge |
0 |
| database_cross_reference |
CAS:556-03-6 Beilstein:515881 PMID:17190852 Gmelin:27744 Reaxys:515881 CAS:55520-40-6 KNApSAcK:C00001397 KEGG:C01536 |
| definition |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
| formula |
C9H11NO3 |
| has functional parent | |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:9800 CHEBI:15277 CHEBI:27176 |
| has_exact_synonym |
Tyrosine tyrosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
tirosina 2-amino-3-(4-hydroxyphenyl)propanoic acid Y Tyr 3-(p-Hydroxyphenyl)alanine 2-Amino-3-(p-hydroxyphenyl)propionic acid Tyrosin |
| id |
CHEBI:18186 |
| in_subset | |
| inchi |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| inchikey |
OUYCCCASQSFEME-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
tyrosine |
| mass |
181.18858 |
| monoisotopicmass |
181.074 |
| notation |
CHEBI:18186 |
| prefLabel |
tyrosine |
| smiles |
NC(Cc1ccc(O)cc1)C(O)=O |
| treeView | |
| subClassOf |