Jump to:
loading...| Preferred Name |
purine ribonucleoside |
| Synonyms |
purine ribonucleosides |
| Definitions |
A ribonucleoside that has a purine moiety as the nucleobase (the R group in the illustration). |
| ID |
http://purl.obolibrary.org/obo/CHEBI_26399 |
| charge |
0 |
| definition |
A ribonucleoside that has a purine moiety as the nucleobase (the R group in the illustration). |
| formula |
C5H9O4R |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
purine ribonucleosides |
| id |
CHEBI:26399 |
| in_subset | |
| label |
purine ribonucleoside |
| mass |
133.123 |
| monoisotopicmass |
133.050 |
| notation |
CHEBI:26399 |
| prefLabel |
purine ribonucleoside |
| smiles |
*[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_26399 | Human Phenotype Ontology China | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_26399 | Human Phenotype Ontology China | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_26399 | GenEpiO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_26399 | GenEpiO | SAME_URI |