| Preferred Name |
tryptophan |
| Synonyms |
tryptophane Tryptophan triptofano 2-amino-3-(1H-indol-3-yl)propanoic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid Htrp W tryptophan Trp alpha-amino-beta-3-indolepropionic acid |
| Definitions |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_27897 |
| charge |
0 |
| database_cross_reference |
CAS:54-12-6 LINCS:LSM-36836 Beilstein:86196 Reaxys:86196 PMID:17439666 Gmelin:4532 KNApSAcK:C00001396 KEGG:C00806 PMID:22264337 Wikipedia:Tryptophan |
| definition |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
| formula |
C11H12N2O2 |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:27163 CHEBI:9769 |
| has_exact_synonym |
Tryptophan tryptophan |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
tryptophane triptofano 2-amino-3-(1H-indol-3-yl)propanoic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid Htrp W Trp alpha-amino-beta-3-indolepropionic acid |
| id |
CHEBI:27897 |
| in_subset | |
| inchi |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| inchikey |
QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| is tautomer of | |
| label |
tryptophan |
| mass |
204.22526 |
| monoisotopicmass |
204.090 |
| notation |
CHEBI:27897 |
| prefLabel |
tryptophan |
| smiles |
NC(Cc1c[nH]c2ccccc12)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38631 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38631 |