| Preferred Name |
carbamic acid |
| Synonyms |
Carbamidsaeure Carbamate carbamic acid Aminoformic acid Aminoameisensaeure CARBAMIC ACID Carbamic acid |
| Definitions |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28616 |
| charge |
0 |
| database_cross_reference |
KEGG:C01563 DrugBank:DB04261 CAS:463-77-4 Beilstein:1734754 Gmelin:130345 Wikipedia:Carbamic_acid PDBeChem:OUT |
| definition |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
| formula |
CH3NO2 |
| has role | |
| has_alternative_id |
CHEBI:23002 CHEBI:3386 CHEBI:44573 CHEBI:22504 |
| has_exact_synonym |
carbamic acid CARBAMIC ACID Carbamic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Carbamidsaeure Carbamate Aminoformic acid Aminoameisensaeure |
| id |
CHEBI:28616 |
| in_subset | |
| inchi |
InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
| inchikey |
KXDHJXZQYSOELW-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
carbamic acid |
| mass |
61.04006 |
| monoisotopicmass |
61.016 |
| notation |
CHEBI:28616 |
| prefLabel |
carbamic acid |
| smiles |
NC(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35352 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35352 |