| Preferred Name |
arginine |
| Synonyms |
2-amino-5-guanidinopentanoic acid arginine Harg 2-amino-5-(carbamimidamido)pentanoic acid Arginine 2-Amino-5-guanidinovaleric acid Arginin |
| Definitions |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_29016 |
| charge |
0 |
| database_cross_reference |
KEGG:C02385 PMID:10848923 CAS:7200-25-1 Wikipedia:L-Arginine Beilstein:1725411 Reaxys:1725411 |
| definition |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
| formula |
C6H14N4O2 |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:2643 CHEBI:22616 |
| has_exact_synonym |
arginine Arginine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-amino-5-guanidinopentanoic acid Harg 2-amino-5-(carbamimidamido)pentanoic acid 2-Amino-5-guanidinovaleric acid Arginin |
| id |
CHEBI:29016 |
| in_subset | |
| inchi |
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| inchikey |
ODKSFYDXXFIFQN-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
arginine |
| mass |
174.20112 |
| monoisotopicmass |
174.112 |
| notation |
CHEBI:29016 |
| prefLabel |
arginine |
| smiles |
NC(CCCNC(N)=N)C(O)=O |
| treeView | |
| subClassOf |