| Preferred Name |
estradiol |
| Synonyms |
oestradiol estra-1,3,5(10)-triene-3,17-diol |
| Definitions |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_23965 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Estradiol PMID:10696569 PMID:24084694 |
| definition |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
| formula |
C18H24O2 |
| has role | |
| has_alternative_id |
CHEBI:42364 |
| has_exact_synonym |
estra-1,3,5(10)-triene-3,17-diol |
| has_obo_namespace |
chebi_ontology |
| has_parent_hydride | |
| has_related_synonym |
oestradiol |
| id |
CHEBI:23965 |
| in_subset | |
| inchi |
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
| inchikey |
VOXZDWNPVJITMN-WKUFJEKOSA-N |
| label |
estradiol |
| mass |
272.38196 |
| monoisotopicmass |
272.17763 |
| notation |
CHEBI:23965 |
| prefLabel |
estradiol |
| smiles |
[H][C@]12CC[C@]3(C)C(O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21 |
| subClassOf |