| Preferred Name |
gamma-aminobutyrate |
| Synonyms |
gamma-aminobutyrate anion 4-Aminobutylate 4-Amino-butyrat 4-aminobutyrate 4-aminobutanoate gamma-aminobutanoate 4-aminobutanoic acid ion (1-) |
| Definitions |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_30566 |
| charge |
-1 |
| database_cross_reference |
KEGG:C00334 Reaxys:3536873 Gmelin:559138 Beilstein:3536873 PMID:12509893 |
| definition |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
| formula |
C4H8NO2 |
| has role | |
| has_alternative_id |
CHEBI:20317 CHEBI:11961 |
| has_exact_synonym |
4-aminobutanoate |
| has_functional_parent | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
gamma-aminobutyrate anion 4-Aminobutylate 4-Amino-butyrat 4-aminobutyrate gamma-aminobutanoate 4-aminobutanoic acid ion (1-) |
| id |
CHEBI:30566 |
| in_subset | |
| inchi |
InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/p-1 |
| inchikey |
BTCSSZJGUNDROE-UHFFFAOYSA-M |
| is_conjugate_base_of | |
| label |
gamma-aminobutyrate |
| mass |
102.11186 |
| monoisotopicmass |
102.05605 |
| notation |
CHEBI:30566 |
| prefLabel |
gamma-aminobutyrate |
| smiles |
NCCCC([O-])=O |
| subClassOf |