loading...| Preferred Name |
adenine |
| Synonyms |
Adenine ADENINE A 9H-purin-6-amine adenine Adenin 6-Aminopurine Ade |
| Definitions |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16708 |
| charge |
0 |
| database_cross_reference |
PMID:12951489 Wikipedia:Adenine PMID:8070089 PMID:12829005 DrugBank:DB00173 CAS:73-24-5 PDBeChem:ADE PMID:17439666 KEGG:C00147 Gmelin:3903 PMID:15063338 Beilstein:608603 HMDB:HMDB0000034 MetaCyc:ADENINE KNApSAcK:C00001490 PMID:11985597 KEGG:D00034 Drug_Central:89 PMID:15715490 Reaxys:608603 |
| definition |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
| formula |
C5H5N5 |
| has_alternative_id |
CHEBI:22236 CHEBI:13733 CHEBI:40579 CHEBI:2470 |
| has_exact_synonym |
Adenine ADENINE 9H-purin-6-amine adenine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
A Adenin 6-Aminopurine Ade |
| id |
CHEBI:16708 |
| in_subset | |
| inchi |
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) |
| inchikey |
GFFGJBXGBJISGV-UHFFFAOYSA-N |
| label |
adenine |
| mass |
135.12690 |
| monoisotopicmass |
135.054 |
| notation |
CHEBI:16708 |
| prefLabel |
adenine |
| smiles |
Nc1ncnc2[nH]cnc12 |
| subClassOf |
http://purl.obolibrary.org/obo/GOCHE_75772 http://purl.obolibrary.org/obo/GOCHE_76971 http://purl.obolibrary.org/obo/GOCHE_75771 http://purl.obolibrary.org/obo/GOCHE_83056 http://purl.obolibrary.org/obo/CHEBI_26386 |