loading...| Preferred Name |
cystine |
| Synonyms |
Cystin alpha-Diamino-beta-dithiolactic acid 3,3'-disulfanediylbis(2-aminopropanoic acid) cystine Dicysteine cistina 3,3'-dithiobis(2-aminopropanoic acid) Cystine Zystin |
| Definitions |
A sulfur-containing amino acid obtained by the oxidation of two cysteine molecules which are then linked via a disulfide bond. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17376 |
| charge |
0 |
| database_cross_reference |
KEGG:C01420 PMID:24327171 Reaxys:1728091 Wikipedia:Cystine PMID:24525030 PMID:24525029 PMID:18608550 Beilstein:1728091 CAS:923-32-0 Gmelin:83347 |
| definition |
A sulfur-containing amino acid obtained by the oxidation of two cysteine molecules which are then linked via a disulfide bond. |
| formula |
C6H12N2O4S2 |
| has_alternative_id |
CHEBI:4052 CHEBI:14062 CHEBI:23513 |
| has_exact_synonym |
3,3'-disulfanediylbis(2-aminopropanoic acid) cystine Cystine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Cystin alpha-Diamino-beta-dithiolactic acid Dicysteine cistina 3,3'-dithiobis(2-aminopropanoic acid) Zystin |
| id |
CHEBI:17376 |
| in_subset | |
| inchi |
InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| inchikey |
LEVWYRKDKASIDU-UHFFFAOYSA-N |
| label |
cystine |
| mass |
240.30256 |
| monoisotopicmass |
240.024 |
| notation |
CHEBI:17376 |
| prefixIRI |
CHEBI:17376 |
| prefLabel |
cystine |
| smiles |
NC(CSSCC(N)C(O)=O)C(O)=O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26834 http://purl.obolibrary.org/obo/GOCHE_75771 http://purl.obolibrary.org/obo/GOCHE_77746 |