loading...| Preferred Name |
cystathionine |
| Synonyms |
DL-Cystathionine 2-amino-4-[(2-amino-2-carboxyethyl)sulfanyl]butanoic acid S-(2-amino-2-carboxyethyl)homocysteine cystathione Cystathionine cystathionine |
| Definitions |
A modified amino acid generated by enzymic means from homocysteine and serine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17755 |
| charge |
0 |
| database_cross_reference |
PMID:15033753 Reaxys:2416815 PMID:22212096 PMID:22264337 PMID:12907234 KEGG:C00542 CAS:535-34-2 |
| definition |
A modified amino acid generated by enzymic means from homocysteine and serine. |
| formula |
C7H14N2O4S |
| has_alternative_id |
CHEBI:14059 CHEBI:4048 |
| has_exact_synonym |
2-amino-4-[(2-amino-2-carboxyethyl)sulfanyl]butanoic acid S-(2-amino-2-carboxyethyl)homocysteine Cystathionine cystathionine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
DL-Cystathionine cystathione |
| id |
CHEBI:17755 |
| in_subset | |
| inchi |
InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| inchikey |
ILRYLPWNYFXEMH-UHFFFAOYSA-N |
| label |
cystathionine |
| mass |
222.26314 |
| monoisotopicmass |
222.067 |
| notation |
CHEBI:17755 |
| prefixIRI |
CHEBI:17755 |
| prefLabel |
cystathionine |
| smiles |
NC(CCSCC(N)C(O)=O)C(O)=O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23505 |