loading...| Preferred Name |
butyrate |
| Synonyms |
1-propanecarboxylate n-butyrate propanecarboxylate 1-butyrate butanoic acid, ion(1-) butyrate CH3-[CH2]2-COO(-) butanoate butanate n-butanoate propylformate 1-butanoate |
| Definitions |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17968 |
| charge |
-1 |
| database_cross_reference |
PMID:7496326 KEGG:C00246 Beilstein:3601060 PMID:17190852 UM-BBD_compID:c0035 MetaCyc:BUTYRIC_ACID Reaxys:3601060 CAS:461-55-2 Gmelin:324289 |
| definition |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
| formula |
C4H7O2 |
| has_alternative_id |
CHEBI:22946 CHEBI:13924 |
| has_exact_synonym |
butyrate butanoate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
1-propanecarboxylate n-butyrate propanecarboxylate 1-butyrate butanoic acid, ion(1-) CH3-[CH2]2-COO(-) butanoate butanate n-butanoate propylformate 1-butanoate |
| id |
CHEBI:17968 |
| in_subset | |
| inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-M |
| label |
butyrate |
| mass |
87.09718 |
| monoisotopicmass |
87.045 |
| notation |
CHEBI:17968 |
| prefLabel |
butyrate |
| smiles |
CCCC([O-])=O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78115 |