Preferred Name |
leucine |
Synonyms |
(+-)-Leucine 2-amino-4-methylpentanoic acid Leu Leuzin (RS)-Leucine DL-Leucine Leucin leucine L Hleu |
Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
charge |
0 |
database_cross_reference |
Gmelin:50203 KEGG:C16439 PMID:17439666 LIPID_MAPS_instance:LMFA01100048 Beilstein:636005 CAS:328-39-2 Wikipedia:Leucine Reaxys:636005 |
definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
formula |
C6H13NO2 |
has part | |
has_exact_synonym |
leucine |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
(+-)-Leucine 2-amino-4-methylpentanoic acid Leu Leuzin (RS)-Leucine DL-Leucine Leucin L Hleu |
id |
CHEBI:25017 |
in_subset | |
inchi |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
inchikey |
ROHFNLRQFUQHCH-UHFFFAOYSA-N |
label |
leucine |
mass |
131.17296 |
monoisotopicmass |
131.095 |
notation |
CHEBI:25017 |
prefixIRI |
CHEBI:25017 |
prefLabel |
leucine |
smiles |
CC(C)CC(N)C(O)=O |
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22918 |