Jump to:
loading...| Preferred Name |
sphing-4-enine |
| Synonyms |
(2S,3R)-2-aminooctadec-4-ene-1,3-diol 4-sphingenine sphing-4-enine |
| Definitions |
A sphingenine in which the C=C double bond is located at the 4-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_26743 |
| charge |
0 |
| database_cross_reference |
Beilstein:7794904 LINCS:LSM-5718 |
| definition |
A sphingenine in which the C=C double bond is located at the 4-position. |
| formula |
C18H37NO2 |
| has_exact_synonym |
(2S,3R)-2-aminooctadec-4-ene-1,3-diol sphing-4-enine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
4-sphingenine |
| id |
CHEBI:26743 |
| in_subset | |
| inchi |
InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/t17-,18+/m0/s1 |
| inchikey |
WWUZIQQURGPMPG-ZWKOTPCHSA-N |
| label |
sphing-4-enine |
| mass |
299.49192 |
| monoisotopicmass |
299.282 |
| notation |
CHEBI:26743 |
| prefLabel |
sphing-4-enine |
| smiles |
[H]C(CCCCCCCCCCCCC)=C([H])[C@@H](O)[C@@H](N)CO |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_26743 | Chemical Entities of Biological Interest Ontology | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_26743 | Chemical Entities of Biological Interest Ontology | SAME_URI |