loading...| Preferred Name |
folic acid |
| Synonyms |
N-pteroyl-L-glutamic acid N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid pteroyl-L-monoglutamic acid pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid vitamin Bc Folic acid Pteroylglutamic acid FOLIC ACID PteGlu vitamin M Folate Folsaeure PGA |
| Definitions |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_27470 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Folic_Acid DrugBank:DB00158 PMID:9040515 PMID:18788725 PMID:19355913 PMID:11261364 Drug_Central:1231 Beilstein:100781 PMID:14387833 PMID:11451208 PMID:17784727 KEGG:C00504 MetaCyc:CPD-12826 KEGG:D00070 PMID:24650098 CAS:59-30-3 LINCS:LSM-5355 KNApSAcK:C00001539 Reaxys:100781 PDBeChem:FOL PMID:15754725 |
| definition |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
| formula |
C19H19N7O6 |
| has_alternative_id |
CHEBI:42610 CHEBI:24075 CHEBI:5140 CHEBI:569217 |
| has_exact_synonym |
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid Folic acid FOLIC ACID |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N-pteroyl-L-glutamic acid pteroyl-L-monoglutamic acid pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid vitamin Bc Pteroylglutamic acid PteGlu vitamin M Folate Folsaeure PGA |
| id |
CHEBI:27470 |
| in_subset | |
| inchi |
InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
| inchikey |
OVBPIULPVIDEAO-LBPRGKRZSA-N |
| label |
folic acid |
| mass |
441.39750 |
| monoisotopicmass |
441.140 |
| notation |
CHEBI:27470 |
| prefixIRI |
CHEBI:27470 |
| prefLabel |
folic acid |
| smiles |
Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37445 http://purl.obolibrary.org/obo/GOCHE_75771 http://purl.obolibrary.org/obo/GOCHE_75769 |