Preferred Name |
carbamic acid |
Synonyms |
Carbamidsaeure Carbamate carbamic acid Aminoformic acid Aminoameisensaeure CARBAMIC ACID Carbamic acid |
Definitions |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
ID |
http://purl.obolibrary.org/obo/CHEBI_28616 |
charge |
0 |
database_cross_reference |
KEGG:C01563 DrugBank:DB04261 CAS:463-77-4 Beilstein:1734754 Gmelin:130345 Wikipedia:Carbamic_acid PDBeChem:OUT |
definition |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
formula |
CH3NO2 |
has_alternative_id |
CHEBI:23002 CHEBI:3386 CHEBI:44573 CHEBI:22504 |
has_exact_synonym |
carbamic acid CARBAMIC ACID Carbamic acid |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
Carbamidsaeure Carbamate Aminoformic acid Aminoameisensaeure |
id |
CHEBI:28616 |
in_subset | |
inchi |
InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
inchikey |
KXDHJXZQYSOELW-UHFFFAOYSA-N |
label |
carbamic acid |
mass |
61.04006 |
monoisotopicmass |
61.016 |
notation |
CHEBI:28616 |
prefLabel |
carbamic acid |
smiles |
NC(O)=O |
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35352 http://purl.obolibrary.org/obo/GOCHE_76971 |