| Preferred Name |
2-amino-3-hydroxybutanoic acid |
| Synonyms |
2-amino-3-hydroxybutanoic acid |
| Definitions |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_38263 |
| charge |
0 |
| database_cross_reference |
Beilstein:1098902 |
| definition |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
| formula |
C4H9NO3 |
| has_exact_synonym |
2-amino-3-hydroxybutanoic acid |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:38263 |
| in_subset | |
| inchi |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
| inchikey |
AYFVYJQAPQTCCC-UHFFFAOYSA-N |
| label |
2-amino-3-hydroxybutanoic acid |
| mass |
119.11920 |
| monoisotopicmass |
119.058 |
| notation |
CHEBI:38263 |
| prefLabel |
2-amino-3-hydroxybutanoic acid |
| smiles |
CC(O)C(N)C(O)=O |
| subClassOf |