Preferred Name |
retinol |
Synonyms |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol retinol |
Definitions |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
ID |
http://purl.obolibrary.org/obo/CHEBI_50211 |
charge |
0 |
database_cross_reference |
MetaCyc:Retinols LINCS:LSM-5317 |
definition |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
formula |
C20H30O |
has_alternative_id |
CHEBI:15037 CHEBI:26538 |
has_exact_synonym |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol retinol |
has_obo_namespace |
chebi_ontology |
id |
CHEBI:50211 |
in_subset | |
inchi |
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3 |
inchikey |
FPIPGXGPPPQFEQ-UHFFFAOYSA-N |
label |
retinol |
mass |
286.45160 |
monoisotopicmass |
286.230 |
notation |
CHEBI:50211 |
prefLabel |
retinol |
smiles |
CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CCO |
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26537 |