Jump to:
loading...| Preferred Name |
valine |
| Synonyms |
valina 2-amino-3-methylbutanoic acid valine Valin Hval DL-valine |
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_27266 |
| charge |
0 |
| database_cross_reference |
PMID:22770225 Beilstein:506689 Reaxys:506689 PMID:17190852 Wikipedia:Valine CAS:516-06-3 KEGG:C16436 Gmelin:49877 |
| formula |
C5H11NO2 |
| has exact synonym |
valine |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
valina 2-amino-3-methylbutanoic acid Valin Hval DL-valine |
| id |
CHEBI:27266 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| inchikey |
KZSNJWFQEVHDMF-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
valine |
| mass |
117.14638 |
| monoisotopicmass |
117.07898 |
| notation |
CHEBI:27266 |
| prefLabel |
valine |
| smiles |
CC(C)C(N)C(O)=O |
| textual definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
| has_part | |
| subClassOf |
Create New Mapping