Preferred Name |
phenylalanine |
Synonyms |
DL-Phenylalanine fenilalanina 2-amino-3-phenylpropanoic acid Phenylalanine PHE Phenylalanin alpha-Amino-beta-phenylpropionic acid F phenylalanine |
Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
charge |
0 |
database_cross_reference |
PMID:17439666 Gmelin:50836 Wikipedia:Phenylalanine Beilstein:1910407 PMID:22264337 KEGG:C02057 CAS:150-30-1 Reaxys:1910407 |
formula |
C9H11NO2 |
has exact synonym |
2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
has role | |
has_alternative_id |
CHEBI:8089 CHEBI:25984 |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
DL-Phenylalanine fenilalanina PHE Phenylalanin alpha-Amino-beta-phenylpropionic acid F |
id |
CHEBI:28044 |
imported from | |
in subset | |
inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
is conjugate acid of | |
is conjugate base of | |
label |
phenylalanine |
mass |
165.18918 |
monoisotopicmass |
165.07898 |
notation |
CHEBI:28044 |
prefLabel |
phenylalanine |
smiles |
NC(Cc1ccccc1)C(O)=O |
textual definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
subClassOf | |
has_part |